C17H26Si — CID 90726871
2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl-dimethyl-phenylsilane (PubChem CID 90726871) has the molecular formula C17H26Si and a molecular weight of 258.48 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl-dimethyl-phenylsilane.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 90726871 |
| Molecular Formula | C17H26Si |
| Molecular Weight | 258.48 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl-dimethyl-phenylsilane |
| SMILES | C[Si](C)(c1ccccc1)C1CCC2CCCCC21 |
| InChI | InChI=1S/C17H26Si/c1-18(2,15-9-4-3-5-10-15)17-13-12-14-8-6-7-11-16(14)17/h3-5,9-10,14,16-17H,6-8,11-13H2,1-2H3 |
| InChIKey | XJTRROQOIFAKEC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.48 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|