C22H36OSi — CID 11067934
[(2R,3S)-2-butyl-4-cyclohexyloxolan-3-yl]-dimethyl-phenylsilane (PubChem CID 11067934) has the molecular formula C22H36OSi and a molecular weight of 344.62 g/mol. Its IUPAC name is [(2R,3S)-2-butyl-4-cyclohexyloxolan-3-yl]-dimethyl-phenylsilane.
| Compound Name | [(2R,3S)-2-butyl-4-cyclohexyloxolan-3-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 11067934 |
| Molecular Formula | C22H36OSi |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | [(2R,3S)-2-butyl-4-cyclohexyloxolan-3-yl]-dimethyl-phenylsilane |
| SMILES | CCCC[C@H]1OCC(C2CCCCC2)[C@@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H36OSi/c1-4-5-16-21-22(24(2,3)19-14-10-7-11-15-19)20(17-23-21)18-12-8-6-9-13-18/h7,10-11,14-15,18,20-22H,4-6,8-9,12-13,16-17H2,1-3H3/t20?,21-,22+/m1/s1 |
| InChIKey | WFARUEUCPCTXOK-PDQYLBCOSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|