C35H46OSi2 — CID 11135314
1-cyclohexylnon-2-ynoxy-[dimethyl(phenyl)silyl]-diphenylsilane (PubChem CID 11135314) has the molecular formula C35H46OSi2 and a molecular weight of 538.92 g/mol. Its IUPAC name is 1-cyclohexylnon-2-ynoxy-[dimethyl(phenyl)silyl]-diphenylsilane.
| Compound Name | 1-cyclohexylnon-2-ynoxy-[dimethyl(phenyl)silyl]-diphenylsilane |
|---|---|
| PubChem CID | 11135314 |
| Molecular Formula | C35H46OSi2 |
| Molecular Weight | 538.92 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | 1-cyclohexylnon-2-ynoxy-[dimethyl(phenyl)silyl]-diphenylsilane |
| SMILES | CCCCCCC#CC(O[Si](c1ccccc1)(c1ccccc1)[Si](C)(C)c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C35H46OSi2/c1-4-5-6-7-8-21-30-35(31-22-13-9-14-23-31)36-38(33-26-17-11-18-27-33,34-28-19-12-20-29-34)37(2,3)32-24-15-10-16-25-32/h10-12,15-20,24-29,31,35H,4-9,13-14,22-23H2,1-3H3 |
| InChIKey | XLZWHZHKVGBTPL-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.92 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|