C20H28O3 — CID 101000915
1-[(2R,3S)-3-phenylmethoxyoxan-2-yl]oct-2-yn-1-ol (PubChem CID 101000915) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 1-[(2R,3S)-3-phenylmethoxyoxan-2-yl]oct-2-yn-1-ol.
| Compound Name | 1-[(2R,3S)-3-phenylmethoxyoxan-2-yl]oct-2-yn-1-ol |
|---|---|
| PubChem CID | 101000915 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 1-[(2R,3S)-3-phenylmethoxyoxan-2-yl]oct-2-yn-1-ol |
| SMILES | CCCCCC#CC(O)[C@H]1OCCC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H28O3/c1-2-3-4-5-9-13-18(21)20-19(14-10-15-22-20)23-16-17-11-7-6-8-12-17/h6-8,11-12,18-21H,2-5,10,14-16H2,1H3/t18?,19-,20+/m0/s1 |
| InChIKey | OKDSKABPABUGHM-NRRUETGQSA-N |
| XLogP | 3.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|