About 4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol
4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol (PubChem CID 10945177) has the molecular formula C16H20O3
and a molecular weight of 260.33 g/mol. Its IUPAC name is 4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol.
Molecular Properties
| Compound Name | 4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol |
| PubChem CID | 10945177 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol |
| SMILES | CC(O)C#C[C@H]1OCCC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C16H20O3/c1-13(17)9-10-16-15(8-5-11-18-16)19-12-14-6-3-2-4-7-14/h2-4,6-7,13,15-17H,5,8,11-12H2,1H3/t13?,15-,16-/m1/s1 |
| InChIKey | SVVCJQBWOBCAIZ-GNHXQJIDSA-N |
| XLogP | 2.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol?
The IUPAC name of 4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol (CID 10945177) is 4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol.
What is the SMILES notation for 4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol?
The canonical SMILES for 4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol is CC(O)C#C[C@H]1OCCC[C@H]1OCc1ccccc1.
What is the InChIKey of 4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol?
The InChIKey is SVVCJQBWOBCAIZ-GNHXQJIDSA-N. The full InChI is InChI=1S/C16H20O3/c1-13(17)9-10-16-15(8-5-11-18-16)19-12-14-6-3-2-4-7-14/h2-4,6-7,13,15-17H,5,8,11-12H2,1H3/t13?,15-,16-/m1/s1.
What are the key properties of 4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol?
4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol has a molecular weight of 260.33 g/mol, XLogP of 2.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,3R)-3-phenylmethoxyoxan-2-yl]but-3-yn-2-ol is sourced from PubChem (CID 10945177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).