C20H23NO4 — CID 102510511
benzyl N-[(2S,3S)-3-phenylmethoxyoxan-2-yl]carbamate (PubChem CID 102510511) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-3-phenylmethoxyoxan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S)-3-phenylmethoxyoxan-2-yl]carbamate |
|---|---|
| PubChem CID | 102510511 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | benzyl N-[(2S,3S)-3-phenylmethoxyoxan-2-yl]carbamate |
| SMILES | O=C(N[C@H]1OCCC[C@@H]1OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C20H23NO4/c22-20(25-15-17-10-5-2-6-11-17)21-19-18(12-7-13-23-19)24-14-16-8-3-1-4-9-16/h1-6,8-11,18-19H,7,12-15H2,(H,21,22)/t18-,19-/m0/s1 |
| InChIKey | RTIYWJLJXHEPNI-OALUTQOASA-N |
| XLogP | 3.63 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |