C24H26O3 — CID 138970902
(4aS,6R,7R,9aR)-6-(2-phenylethynyl)-7-phenylmethoxy-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepine (PubChem CID 138970902) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is (4aS,6R,7R,9aR)-6-(2-phenylethynyl)-7-phenylmethoxy-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepine.
| Compound Name | (4aS,6R,7R,9aR)-6-(2-phenylethynyl)-7-phenylmethoxy-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepine |
|---|---|
| PubChem CID | 138970902 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (4aS,6R,7R,9aR)-6-(2-phenylethynyl)-7-phenylmethoxy-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrano[3,2-b]oxepine |
| SMILES | C(#C[C@H]1O[C@H]2CCCO[C@@H]2CC[C@H]1OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26O3/c1-3-8-19(9-4-1)13-14-24-22(26-18-20-10-5-2-6-11-20)16-15-21-23(27-24)12-7-17-25-21/h1-6,8-11,21-24H,7,12,15-18H2/t21-,22-,23+,24-/m1/s1 |
| InChIKey | OOHFCGUQHBHPKZ-JLLPCOHGSA-N |
| XLogP | 4.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|