C19H22O3 — CID 57372422
(4aS,6R,7S,10aR)-6-ethynyl-7-phenylmethoxy-2,3,4,4a,6,7,8,10a-octahydropyrano[3,2-b]oxocine (PubChem CID 57372422) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (4aS,6R,7S,10aR)-6-ethynyl-7-phenylmethoxy-2,3,4,4a,6,7,8,10a-octahydropyrano[3,2-b]oxocine.
| Compound Name | (4aS,6R,7S,10aR)-6-ethynyl-7-phenylmethoxy-2,3,4,4a,6,7,8,10a-octahydropyrano[3,2-b]oxocine |
|---|---|
| PubChem CID | 57372422 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (4aS,6R,7S,10aR)-6-ethynyl-7-phenylmethoxy-2,3,4,4a,6,7,8,10a-octahydropyrano[3,2-b]oxocine |
| SMILES | C#C[C@H]1O[C@H]2CCCO[C@@H]2C=CC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H22O3/c1-2-16-17(21-14-15-8-4-3-5-9-15)10-6-11-18-19(22-16)12-7-13-20-18/h1,3-6,8-9,11,16-19H,7,10,12-14H2/t16-,17+,18-,19+/m1/s1 |
| InChIKey | VDFJSBJFLBMSRE-HCXYKTFWSA-N |
| XLogP | 3.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|