C21H22O3 — CID 11484097
(2R,3S,5R)-5-ethynyl-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolane (PubChem CID 11484097) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is (2R,3S,5R)-5-ethynyl-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolane.
| Compound Name | (2R,3S,5R)-5-ethynyl-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolane |
|---|---|
| PubChem CID | 11484097 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (2R,3S,5R)-5-ethynyl-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolane |
| SMILES | C#C[C@H]1C[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C21H22O3/c1-2-19-13-20(23-15-18-11-7-4-8-12-18)21(24-19)16-22-14-17-9-5-3-6-10-17/h1,3-12,19-21H,13-16H2/t19-,20-,21+/m0/s1 |
| InChIKey | SADRNMDOUNRNGW-PCCBWWKXSA-N |
| XLogP | 3.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|