C28H26O4 — CID 135078072
3-phenyl-1-[4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]prop-2-yn-1-one (PubChem CID 135078072) has the molecular formula C28H26O4 and a molecular weight of 426.51 g/mol. Its IUPAC name is 3-phenyl-1-[4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]prop-2-yn-1-one.
| Compound Name | 3-phenyl-1-[4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 135078072 |
| Molecular Formula | C28H26O4 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 3-phenyl-1-[4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]prop-2-yn-1-one |
| SMILES | O=C(C#Cc1ccccc1)C1CC(OCc2ccccc2)C(COCc2ccccc2)O1 |
| InChI | InChI=1S/C28H26O4/c29-25(17-16-22-10-4-1-5-11-22)26-18-27(31-20-24-14-8-3-9-15-24)28(32-26)21-30-19-23-12-6-2-7-13-23/h1-15,26-28H,18-21H2 |
| InChIKey | GTJIUFVKQSRANV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|