C37H36O3P+ — CID 11828410
triphenyl-[(2R,4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]phosphanium (PubChem CID 11828410) has the molecular formula C37H36O3P+ and a molecular weight of 559.67 g/mol. Its IUPAC name is triphenyl-[(2R,4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]phosphanium.
| Compound Name | triphenyl-[(2R,4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]phosphanium |
|---|---|
| PubChem CID | 11828410 |
| Molecular Formula | C37H36O3P+ |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | triphenyl-[(2R,4S,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-2-yl]phosphanium |
| SMILES | c1ccc(COC[C@H]2O[C@H]([P+](c3ccccc3)(c3ccccc3)c3ccccc3)C[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C37H36O3P/c1-6-16-30(17-7-1)27-38-29-36-35(39-28-31-18-8-2-9-19-31)26-37(40-36)41(32-20-10-3-11-21-32,33-22-12-4-13-23-33)34-24-14-5-15-25-34/h1-25,35-37H,26-29H2/q+1/t35-,36+,37+/m0/s1 |
| InChIKey | KITMWFRXWGDPDO-HKIDPNTFSA-N |
| XLogP | 6.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|