C27H36O4 — CID 134922663
(2R,3S,5R,7R,8S)-2-[(E)-but-2-enyl]-5-methyl-7-phenylmethoxy-8-(phenylmethoxymethyl)oxocan-3-ol (PubChem CID 134922663) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is (2R,3S,5R,7R,8S)-2-[(E)-but-2-enyl]-5-methyl-7-phenylmethoxy-8-(phenylmethoxymethyl)oxocan-3-ol.
| Compound Name | (2R,3S,5R,7R,8S)-2-[(E)-but-2-enyl]-5-methyl-7-phenylmethoxy-8-(phenylmethoxymethyl)oxocan-3-ol |
|---|---|
| PubChem CID | 134922663 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | (2R,3S,5R,7R,8S)-2-[(E)-but-2-enyl]-5-methyl-7-phenylmethoxy-8-(phenylmethoxymethyl)oxocan-3-ol |
| SMILES | C/C=C/C[C@H]1O[C@@H](COCc2ccccc2)[C@H](OCc2ccccc2)C[C@H](C)C[C@@H]1O |
| InChI | InChI=1S/C27H36O4/c1-3-4-15-25-24(28)16-21(2)17-26(30-19-23-13-9-6-10-14-23)27(31-25)20-29-18-22-11-7-5-8-12-22/h3-14,21,24-28H,15-20H2,1-2H3/b4-3+/t21-,24+,25-,26-,27+/m1/s1 |
| InChIKey | CKKYBLOHONQUFB-VVYJPSTPSA-N |
| XLogP | 5.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|