C25H24O3S — CID 101237260
(2R,3S,5R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-5-(2-thiophen-2-ylethynyl)oxolane (PubChem CID 101237260) has the molecular formula C25H24O3S and a molecular weight of 404.53 g/mol. Its IUPAC name is (2R,3S,5R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-5-(2-thiophen-2-ylethynyl)oxolane.
| Compound Name | (2R,3S,5R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-5-(2-thiophen-2-ylethynyl)oxolane |
|---|---|
| PubChem CID | 101237260 |
| Molecular Formula | C25H24O3S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2R,3S,5R)-3-phenylmethoxy-2-(phenylmethoxymethyl)-5-(2-thiophen-2-ylethynyl)oxolane |
| SMILES | C(#C[C@H]1C[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1)c1cccs1 |
| InChI | InChI=1S/C25H24O3S/c1-3-8-20(9-4-1)17-26-19-25-24(27-18-21-10-5-2-6-11-21)16-22(28-25)13-14-23-12-7-15-29-23/h1-12,15,22,24-25H,16-19H2/t22-,24-,25+/m0/s1 |
| InChIKey | VNOZGQDRLZAPJZ-ZKMPZPQNSA-N |
| XLogP | 5.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|