C23H30O2Si — CID 134867155
[(1S,5S,6S)-5,6-bis(phenylmethoxy)cyclohex-2-en-1-yl]-trimethylsilane (PubChem CID 134867155) has the molecular formula C23H30O2Si and a molecular weight of 366.58 g/mol. Its IUPAC name is [(1S,5S,6S)-5,6-bis(phenylmethoxy)cyclohex-2-en-1-yl]-trimethylsilane.
| Compound Name | [(1S,5S,6S)-5,6-bis(phenylmethoxy)cyclohex-2-en-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 134867155 |
| Molecular Formula | C23H30O2Si |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [(1S,5S,6S)-5,6-bis(phenylmethoxy)cyclohex-2-en-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)[C@H]1C=CC[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H30O2Si/c1-26(2,3)22-16-10-15-21(24-17-19-11-6-4-7-12-19)23(22)25-18-20-13-8-5-9-14-20/h4-14,16,21-23H,15,17-18H2,1-3H3/t21-,22-,23-/m0/s1 |
| InChIKey | INQPVBFCPMRYES-VABKMULXSA-N |
| XLogP | 5.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|