C13H16O2 — CID 102115662
(2S,3S)-2-methyl-3-phenylmethoxy-3,4-dihydro-2H-pyran (PubChem CID 102115662) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2S,3S)-2-methyl-3-phenylmethoxy-3,4-dihydro-2H-pyran.
| Compound Name | (2S,3S)-2-methyl-3-phenylmethoxy-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 102115662 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2S,3S)-2-methyl-3-phenylmethoxy-3,4-dihydro-2H-pyran |
| SMILES | C[C@@H]1OC=CC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C13H16O2/c1-11-13(8-5-9-14-11)15-10-12-6-3-2-4-7-12/h2-7,9,11,13H,8,10H2,1H3/t11-,13-/m0/s1 |
| InChIKey | UUPGAYUHIGLNOT-AAEUAGOBSA-N |
| XLogP | 2.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |