C11H15NO — CID 163409920
(2S,3R)-2-methyl-3-phenylmethoxyazetidine (PubChem CID 163409920) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (2S,3R)-2-methyl-3-phenylmethoxyazetidine.
| Compound Name | (2S,3R)-2-methyl-3-phenylmethoxyazetidine |
|---|---|
| PubChem CID | 163409920 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (2S,3R)-2-methyl-3-phenylmethoxyazetidine |
| SMILES | C[C@@H]1NC[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C11H15NO/c1-9-11(7-12-9)13-8-10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | QYCXFNQODGSKBY-GXSJLCMTSA-N |
| XLogP | 1.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |