C12H15NO4 — CID 71294747
(2S,3S,4S)-3-hydroxy-4-phenylmethoxypyrrolidine-2-carboxylic acid (PubChem CID 71294747) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is (2S,3S,4S)-3-hydroxy-4-phenylmethoxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S,4S)-3-hydroxy-4-phenylmethoxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 71294747 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (2S,3S,4S)-3-hydroxy-4-phenylmethoxypyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1NC[C@H](OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C12H15NO4/c14-11-9(6-13-10(11)12(15)16)17-7-8-4-2-1-3-5-8/h1-5,9-11,13-14H,6-7H2,(H,15,16)/t9-,10-,11+/m0/s1 |
| InChIKey | NOZKFGZJRDPOEQ-GARJFASQSA-N |
| XLogP | -0.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |