C13H14F3NO4 — CID 118161520
(2S)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidine-2-carboxylic acid (PubChem CID 118161520) has the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. Its IUPAC name is (2S)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 118161520 |
| Molecular Formula | C13H14F3NO4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (2S)-3-hydroxy-4-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1NCC(OCc2cccc(C(F)(F)F)c2)C1O |
| InChI | InChI=1S/C13H14F3NO4/c14-13(15,16)8-3-1-2-7(4-8)6-21-9-5-17-10(11(9)18)12(19)20/h1-4,9-11,17-18H,5-6H2,(H,19,20)/t9?,10-,11?/m0/s1 |
| InChIKey | MFZVRSQFGANDMK-YVNMAJEFSA-N |
| XLogP | 1.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |