C14H18F3NO — CID 177205527
(2R,5S)-2-methyl-5-[[3-(trifluoromethyl)phenyl]methoxy]piperidine (PubChem CID 177205527) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is (2R,5S)-2-methyl-5-[[3-(trifluoromethyl)phenyl]methoxy]piperidine.
| Compound Name | (2R,5S)-2-methyl-5-[[3-(trifluoromethyl)phenyl]methoxy]piperidine |
|---|---|
| PubChem CID | 177205527 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (2R,5S)-2-methyl-5-[[3-(trifluoromethyl)phenyl]methoxy]piperidine |
| SMILES | C[C@@H]1CC[C@H](OCc2cccc(C(F)(F)F)c2)CN1 |
| InChI | InChI=1S/C14H18F3NO/c1-10-5-6-13(8-18-10)19-9-11-3-2-4-12(7-11)14(15,16)17/h2-4,7,10,13,18H,5-6,8-9H2,1H3/t10-,13+/m1/s1 |
| InChIKey | FRWGWZPOPQYLHL-MFKMUULPSA-N |
| XLogP | 3.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |