C12H15F3N2O — CID 177207225
2-[(3S,6R)-6-methylpiperidin-3-yl]oxy-6-(trifluoromethyl)pyridine (PubChem CID 177207225) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 2-[(3S,6R)-6-methylpiperidin-3-yl]oxy-6-(trifluoromethyl)pyridine.
| Compound Name | 2-[(3S,6R)-6-methylpiperidin-3-yl]oxy-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 177207225 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-[(3S,6R)-6-methylpiperidin-3-yl]oxy-6-(trifluoromethyl)pyridine |
| SMILES | C[C@@H]1CC[C@H](Oc2cccc(C(F)(F)F)n2)CN1 |
| InChI | InChI=1S/C12H15F3N2O/c1-8-5-6-9(7-16-8)18-11-4-2-3-10(17-11)12(13,14)15/h2-4,8-9,16H,5-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | AUUUXMSNJVGBOT-BDAKNGLRSA-N |
| XLogP | 2.62 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |