C12H15F3N2O — CID 62348885
2-(piperidin-3-ylmethoxy)-6-(trifluoromethyl)pyridine (PubChem CID 62348885) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is 2-(piperidin-3-ylmethoxy)-6-(trifluoromethyl)pyridine.
| Compound Name | 2-(piperidin-3-ylmethoxy)-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 62348885 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | 2-(piperidin-3-ylmethoxy)-6-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cccc(OCC2CCCNC2)n1 |
| InChI | InChI=1S/C12H15F3N2O/c13-12(14,15)10-4-1-5-11(17-10)18-8-9-3-2-6-16-7-9/h1,4-5,9,16H,2-3,6-8H2 |
| InChIKey | WXOAGZXXKMBPKL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |