C13H17F3N2O — CID 117095791
2-(piperidin-3-ylmethoxy)-5-(trifluoromethyl)aniline (PubChem CID 117095791) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 2-(piperidin-3-ylmethoxy)-5-(trifluoromethyl)aniline.
| Compound Name | 2-(piperidin-3-ylmethoxy)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 117095791 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-(piperidin-3-ylmethoxy)-5-(trifluoromethyl)aniline |
| SMILES | Nc1cc(C(F)(F)F)ccc1OCC1CCCNC1 |
| InChI | InChI=1S/C13H17F3N2O/c14-13(15,16)10-3-4-12(11(17)6-10)19-8-9-2-1-5-18-7-9/h3-4,6,9,18H,1-2,5,7-8,17H2 |
| InChIKey | KRAGDIKJADDGQZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|