C10H10F3NOS — CID 126954786
2-(thiolan-3-yloxy)-6-(trifluoromethyl)pyridine (PubChem CID 126954786) has the molecular formula C10H10F3NOS and a molecular weight of 249.26 g/mol. Its IUPAC name is 2-(thiolan-3-yloxy)-6-(trifluoromethyl)pyridine.
| Compound Name | 2-(thiolan-3-yloxy)-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 126954786 |
| Molecular Formula | C10H10F3NOS |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 2-(thiolan-3-yloxy)-6-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cccc(OC2CCSC2)n1 |
| InChI | InChI=1S/C10H10F3NOS/c11-10(12,13)8-2-1-3-9(14-8)15-7-4-5-16-6-7/h1-3,7H,4-6H2 |
| InChIKey | FIOVKFITDBTTPE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |