C16H16F3NO4 — CID 146568370
(2S,3S)-1-prop-2-enoyl-3-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidine-2-carboxylic acid (PubChem CID 146568370) has the molecular formula C16H16F3NO4 and a molecular weight of 343.30 g/mol. Its IUPAC name is (2S,3S)-1-prop-2-enoyl-3-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S)-1-prop-2-enoyl-3-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 146568370 |
| Molecular Formula | C16H16F3NO4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (2S,3S)-1-prop-2-enoyl-3-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidine-2-carboxylic acid |
| SMILES | C=CC(=O)N1CC[C@H](OCc2cccc(C(F)(F)F)c2)[C@H]1C(=O)O |
| InChI | InChI=1S/C16H16F3NO4/c1-2-13(21)20-7-6-12(14(20)15(22)23)24-9-10-4-3-5-11(8-10)16(17,18)19/h2-5,8,12,14H,1,6-7,9H2,(H,22,23)/t12-,14-/m0/s1 |
| InChIKey | DETAILHLTCIFKI-JSGCOSHPSA-N |
| XLogP | 2.46 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|