C19H17F3N4O2 — CID 166100734
1-[(3R,4R)-1-prop-2-enoyl-4-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyrazole-3-carbonitrile (PubChem CID 166100734) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is 1-[(3R,4R)-1-prop-2-enoyl-4-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyrazole-3-carbonitrile.
| Compound Name | 1-[(3R,4R)-1-prop-2-enoyl-4-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyrazole-3-carbonitrile |
|---|---|
| PubChem CID | 166100734 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-[(3R,4R)-1-prop-2-enoyl-4-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]pyrazole-3-carbonitrile |
| SMILES | C=CC(=O)N1C[C@@H](n2ccc(C#N)n2)[C@H](OCc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C19H17F3N4O2/c1-2-18(27)25-10-16(26-7-6-15(9-23)24-26)17(11-25)28-12-13-4-3-5-14(8-13)19(20,21)22/h2-8,16-17H,1,10-12H2/t16-,17-/m1/s1 |
| InChIKey | YZTSKOQELPPIFW-IAGOWNOFSA-N |
| XLogP | 2.93 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|