C20H18F3N4O2+ — CID 166100819
(1Z)-1-[[(4S)-1-prop-2-enoyl-4-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]methylidene]pyrazol-1-ium-4-carbonitrile (PubChem CID 166100819) has the molecular formula C20H18F3N4O2+ and a molecular weight of 403.38 g/mol. Its IUPAC name is (1Z)-1-[[(4S)-1-prop-2-enoyl-4-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]methylidene]pyrazol-1-ium-4-carbonitrile.
| Compound Name | (1Z)-1-[[(4S)-1-prop-2-enoyl-4-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]methylidene]pyrazol-1-ium-4-carbonitrile |
|---|---|
| PubChem CID | 166100819 |
| Molecular Formula | C20H18F3N4O2+ |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (1Z)-1-[[(4S)-1-prop-2-enoyl-4-[[3-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]methylidene]pyrazol-1-ium-4-carbonitrile |
| SMILES | C=CC(=O)N1CC(/C=[N+]2/C=C(C#N)C=N2)[C@H](OCc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C20H18F3N4O2/c1-2-19(28)26-10-16(11-27-9-15(7-24)8-25-27)18(12-26)29-13-14-4-3-5-17(6-14)20(21,22)23/h2-6,8-9,11,16,18H,1,10,12-13H2/q+1/b27-11-/t16?,18-/m1/s1 |
| InChIKey | WNEZERLVRYLEOA-AJYHGXMNSA-N |
| XLogP | 2.73 |
| TPSA | 68.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|