C21H19F3N6O2 — CID 166100714
1-[(3R,4R)-3-(4-pyrimidin-5-yltriazol-1-yl)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 166100714) has the molecular formula C21H19F3N6O2 and a molecular weight of 444.42 g/mol. Its IUPAC name is 1-[(3R,4R)-3-(4-pyrimidin-5-yltriazol-1-yl)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R,4R)-3-(4-pyrimidin-5-yltriazol-1-yl)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166100714 |
| Molecular Formula | C21H19F3N6O2 |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 1-[(3R,4R)-3-(4-pyrimidin-5-yltriazol-1-yl)-4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@@H](n2cc(-c3cncnc3)nn2)[C@H](OCc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C21H19F3N6O2/c1-2-20(31)29-10-18(30-9-17(27-28-30)15-7-25-13-26-8-15)19(11-29)32-12-14-3-5-16(6-4-14)21(22,23)24/h2-9,13,18-19H,1,10-12H2/t18-,19-/m1/s1 |
| InChIKey | PQUMZMPYHMRYRZ-RTBURBONSA-N |
| XLogP | 2.91 |
| TPSA | 86.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|