C18H17F3N6O — CID 174214668
5-[1-[4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]triazol-4-yl]pyrimidine (PubChem CID 174214668) has the molecular formula C18H17F3N6O and a molecular weight of 390.37 g/mol. Its IUPAC name is 5-[1-[4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]triazol-4-yl]pyrimidine.
| Compound Name | 5-[1-[4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]triazol-4-yl]pyrimidine |
|---|---|
| PubChem CID | 174214668 |
| Molecular Formula | C18H17F3N6O |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 5-[1-[4-[[4-(trifluoromethyl)phenyl]methoxy]pyrrolidin-3-yl]triazol-4-yl]pyrimidine |
| SMILES | FC(F)(F)c1ccc(COC2CNCC2n2cc(-c3cncnc3)nn2)cc1 |
| InChI | InChI=1S/C18H17F3N6O/c19-18(20,21)14-3-1-12(2-4-14)10-28-17-8-22-7-16(17)27-9-15(25-26-27)13-5-23-11-24-6-13/h1-6,9,11,16-17,22H,7-8,10H2 |
| InChIKey | SPKRNOSMSYBQEW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |