C18H22N4O3 — CID 167642532
1-[(3R,4R)-3-[4-(hydroxymethyl)triazol-1-yl]-4-[(3-methylphenyl)methoxy]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 167642532) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[(3R,4R)-3-[4-(hydroxymethyl)triazol-1-yl]-4-[(3-methylphenyl)methoxy]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R,4R)-3-[4-(hydroxymethyl)triazol-1-yl]-4-[(3-methylphenyl)methoxy]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167642532 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-[(3R,4R)-3-[4-(hydroxymethyl)triazol-1-yl]-4-[(3-methylphenyl)methoxy]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@@H](n2cc(CO)nn2)[C@H](OCc2cccc(C)c2)C1 |
| InChI | InChI=1S/C18H22N4O3/c1-3-18(24)21-9-16(22-8-15(11-23)19-20-22)17(10-21)25-12-14-6-4-5-13(2)7-14/h3-8,16-17,23H,1,9-12H2,2H3/t16-,17-/m1/s1 |
| InChIKey | DAEGJGBWIFRKQY-IAGOWNOFSA-N |
| XLogP | 1.23 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|