C19H24N4O4S — CID 167569674
1-methyl-N-[(3R,4R)-4-[(3-methylphenyl)methoxy]-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-sulfonamide (PubChem CID 167569674) has the molecular formula C19H24N4O4S and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-methyl-N-[(3R,4R)-4-[(3-methylphenyl)methoxy]-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-sulfonamide.
| Compound Name | 1-methyl-N-[(3R,4R)-4-[(3-methylphenyl)methoxy]-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 167569674 |
| Molecular Formula | C19H24N4O4S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1-methyl-N-[(3R,4R)-4-[(3-methylphenyl)methoxy]-1-prop-2-enoylpyrrolidin-3-yl]pyrazole-4-sulfonamide |
| SMILES | C=CC(=O)N1C[C@@H](NS(=O)(=O)c2cnn(C)c2)[C@H](OCc2cccc(C)c2)C1 |
| InChI | InChI=1S/C19H24N4O4S/c1-4-19(24)23-11-17(21-28(25,26)16-9-20-22(3)10-16)18(12-23)27-13-15-7-5-6-14(2)8-15/h4-10,17-18,21H,1,11-13H2,2-3H3/t17-,18-/m1/s1 |
| InChIKey | RFRWHINCVUVRLR-QZTJIDSGSA-N |
| XLogP | 0.99 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|