C14H17N3O4S — CID 167978269
4-[3-[(1-methylpyrazol-4-yl)sulfonylamino]phenyl]butanoic acid (PubChem CID 167978269) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is 4-[3-[(1-methylpyrazol-4-yl)sulfonylamino]phenyl]butanoic acid.
| Compound Name | 4-[3-[(1-methylpyrazol-4-yl)sulfonylamino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 167978269 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 4-[3-[(1-methylpyrazol-4-yl)sulfonylamino]phenyl]butanoic acid |
| SMILES | Cn1cc(S(=O)(=O)Nc2cccc(CCCC(=O)O)c2)cn1 |
| InChI | InChI=1S/C14H17N3O4S/c1-17-10-13(9-15-17)22(20,21)16-12-6-2-4-11(8-12)5-3-7-14(18)19/h2,4,6,8-10,16H,3,5,7H2,1H3,(H,18,19) |
| InChIKey | WQBLIVCARUCOIN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |