C16H23N5O3S — CID 119438590
N-[3-(ethylaminomethyl)phenyl]-2-[(1-methylpyrazol-4-yl)sulfonylamino]propanamide (PubChem CID 119438590) has the molecular formula C16H23N5O3S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-[3-(ethylaminomethyl)phenyl]-2-[(1-methylpyrazol-4-yl)sulfonylamino]propanamide.
| Compound Name | N-[3-(ethylaminomethyl)phenyl]-2-[(1-methylpyrazol-4-yl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 119438590 |
| Molecular Formula | C16H23N5O3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | N-[3-(ethylaminomethyl)phenyl]-2-[(1-methylpyrazol-4-yl)sulfonylamino]propanamide |
| SMILES | CCNCc1cccc(NC(=O)C(C)NS(=O)(=O)c2cnn(C)c2)c1 |
| InChI | InChI=1S/C16H23N5O3S/c1-4-17-9-13-6-5-7-14(8-13)19-16(22)12(2)20-25(23,24)15-10-18-21(3)11-15/h5-8,10-12,17,20H,4,9H2,1-3H3,(H,19,22) |
| InChIKey | GLXRVZMSSBGJCT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |