C15H21N5O3S — CID 119438203
N-[3-(ethylaminomethyl)phenyl]-3-(4-sulfamoylpyrazol-1-yl)propanamide (PubChem CID 119438203) has the molecular formula C15H21N5O3S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[3-(ethylaminomethyl)phenyl]-3-(4-sulfamoylpyrazol-1-yl)propanamide.
| Compound Name | N-[3-(ethylaminomethyl)phenyl]-3-(4-sulfamoylpyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 119438203 |
| Molecular Formula | C15H21N5O3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-[3-(ethylaminomethyl)phenyl]-3-(4-sulfamoylpyrazol-1-yl)propanamide |
| SMILES | CCNCc1cccc(NC(=O)CCn2cc(S(N)(=O)=O)cn2)c1 |
| InChI | InChI=1S/C15H21N5O3S/c1-2-17-9-12-4-3-5-13(8-12)19-15(21)6-7-20-11-14(10-18-20)24(16,22)23/h3-5,8,10-11,17H,2,6-7,9H2,1H3,(H,19,21)(H2,16,22,23) |
| InChIKey | BKBNMXINRBDTAF-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |