C15H20N4O3S — CID 86980323
N,N-diethyl-3-[(1-methylpyrazol-4-yl)sulfonylamino]benzamide (PubChem CID 86980323) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is N,N-diethyl-3-[(1-methylpyrazol-4-yl)sulfonylamino]benzamide.
| Compound Name | N,N-diethyl-3-[(1-methylpyrazol-4-yl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 86980323 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | N,N-diethyl-3-[(1-methylpyrazol-4-yl)sulfonylamino]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(NS(=O)(=O)c2cnn(C)c2)c1 |
| InChI | InChI=1S/C15H20N4O3S/c1-4-19(5-2)15(20)12-7-6-8-13(9-12)17-23(21,22)14-10-16-18(3)11-14/h6-11,17H,4-5H2,1-3H3 |
| InChIKey | RFUISEWZUMTSBT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |