C18H22N2O4 — CID 167642530
3-[(3R,4R)-4-[(3-methylphenyl)methoxy]-1-prop-2-enoylpyrrolidin-3-yl]-1,3-oxazolidin-2-one (PubChem CID 167642530) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-[(3R,4R)-4-[(3-methylphenyl)methoxy]-1-prop-2-enoylpyrrolidin-3-yl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(3R,4R)-4-[(3-methylphenyl)methoxy]-1-prop-2-enoylpyrrolidin-3-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 167642530 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 3-[(3R,4R)-4-[(3-methylphenyl)methoxy]-1-prop-2-enoylpyrrolidin-3-yl]-1,3-oxazolidin-2-one |
| SMILES | C=CC(=O)N1C[C@@H](N2CCOC2=O)[C@H](OCc2cccc(C)c2)C1 |
| InChI | InChI=1S/C18H22N2O4/c1-3-17(21)19-10-15(20-7-8-23-18(20)22)16(11-19)24-12-14-6-4-5-13(2)9-14/h3-6,9,15-16H,1,7-8,10-12H2,2H3/t15-,16-/m1/s1 |
| InChIKey | MEAAWABSDVUUQK-HZPDHXFCSA-N |
| XLogP | 1.73 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|