C20H23N3O4S — CID 167569670
N-[(3R,4R)-4-[(3-methylphenyl)methoxy]-1-prop-2-enoylpyrrolidin-3-yl]pyridine-3-sulfonamide (PubChem CID 167569670) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[(3R,4R)-4-[(3-methylphenyl)methoxy]-1-prop-2-enoylpyrrolidin-3-yl]pyridine-3-sulfonamide.
| Compound Name | N-[(3R,4R)-4-[(3-methylphenyl)methoxy]-1-prop-2-enoylpyrrolidin-3-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 167569670 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[(3R,4R)-4-[(3-methylphenyl)methoxy]-1-prop-2-enoylpyrrolidin-3-yl]pyridine-3-sulfonamide |
| SMILES | C=CC(=O)N1C[C@@H](NS(=O)(=O)c2cccnc2)[C@H](OCc2cccc(C)c2)C1 |
| InChI | InChI=1S/C20H23N3O4S/c1-3-20(24)23-12-18(22-28(25,26)17-8-5-9-21-11-17)19(13-23)27-14-16-7-4-6-15(2)10-16/h3-11,18-19,22H,1,12-14H2,2H3/t18-,19-/m1/s1 |
| InChIKey | VKGQWRVQNVFQCA-RTBURBONSA-N |
| XLogP | 1.65 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|