C13H18N2O4S — CID 115617333
methyl 4-(pyridin-3-ylsulfonylamino)cyclohexane-1-carboxylate (PubChem CID 115617333) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is methyl 4-(pyridin-3-ylsulfonylamino)cyclohexane-1-carboxylate.
| Compound Name | methyl 4-(pyridin-3-ylsulfonylamino)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 115617333 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | methyl 4-(pyridin-3-ylsulfonylamino)cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NS(=O)(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C13H18N2O4S/c1-19-13(16)10-4-6-11(7-5-10)15-20(17,18)12-3-2-8-14-9-12/h2-3,8-11,15H,4-7H2,1H3 |
| InChIKey | LBAWZGYGZQXOHT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |