C13H17ClN2O4S — CID 115641381
methyl 4-[(2-chloro-3-pyridinyl)sulfonylamino]cyclohexane-1-carboxylate (PubChem CID 115641381) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is methyl 4-[(2-chloro-3-pyridinyl)sulfonylamino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[(2-chloro-3-pyridinyl)sulfonylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 115641381 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | methyl 4-[(2-chloro-3-pyridinyl)sulfonylamino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NS(=O)(=O)c2cccnc2Cl)CC1 |
| InChI | InChI=1S/C13H17ClN2O4S/c1-20-13(17)9-4-6-10(7-5-9)16-21(18,19)11-3-2-8-15-12(11)14/h2-3,8-10,16H,4-7H2,1H3 |
| InChIKey | STGXMWOXBMNKOA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|