C18H27NO4 — CID 167470382
(3-methylphenyl)methyl 4-(2,2-dimethoxyethyl)piperidine-1-carboxylate (PubChem CID 167470382) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (3-methylphenyl)methyl 4-(2,2-dimethoxyethyl)piperidine-1-carboxylate.
| Compound Name | (3-methylphenyl)methyl 4-(2,2-dimethoxyethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167470382 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (3-methylphenyl)methyl 4-(2,2-dimethoxyethyl)piperidine-1-carboxylate |
| SMILES | COC(CC1CCN(C(=O)OCc2cccc(C)c2)CC1)OC |
| InChI | InChI=1S/C18H27NO4/c1-14-5-4-6-16(11-14)13-23-18(20)19-9-7-15(8-10-19)12-17(21-2)22-3/h4-6,11,15,17H,7-10,12-13H2,1-3H3 |
| InChIKey | PUSQRQRBWXEZEL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|