C16H23NO3S — CID 167251366
(3-methylphenyl)methyl 3-(3-hydroxypropylsulfanyl)pyrrolidine-1-carboxylate (PubChem CID 167251366) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is (3-methylphenyl)methyl 3-(3-hydroxypropylsulfanyl)pyrrolidine-1-carboxylate.
| Compound Name | (3-methylphenyl)methyl 3-(3-hydroxypropylsulfanyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 167251366 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (3-methylphenyl)methyl 3-(3-hydroxypropylsulfanyl)pyrrolidine-1-carboxylate |
| SMILES | Cc1cccc(COC(=O)N2CCC(SCCCO)C2)c1 |
| InChI | InChI=1S/C16H23NO3S/c1-13-4-2-5-14(10-13)12-20-16(19)17-7-6-15(11-17)21-9-3-8-18/h2,4-5,10,15,18H,3,6-9,11-12H2,1H3 |
| InChIKey | KHGGWNKRZAMNJJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|