C11H13N3O — CID 24786458
[1-[(3-methylphenyl)methyl]triazol-4-yl]methanol (PubChem CID 24786458) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is [1-[(3-methylphenyl)methyl]triazol-4-yl]methanol.
| Compound Name | [1-[(3-methylphenyl)methyl]triazol-4-yl]methanol |
|---|---|
| PubChem CID | 24786458 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | [1-[(3-methylphenyl)methyl]triazol-4-yl]methanol |
| SMILES | Cc1cccc(Cn2cc(CO)nn2)c1 |
| InChI | InChI=1S/C11H13N3O/c1-9-3-2-4-10(5-9)6-14-7-11(8-15)12-13-14/h2-5,7,15H,6,8H2,1H3 |
| InChIKey | DCPVDVIBCNSKJA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |