C22H26FN5 — CID 155804078
1-[[1-[(3-fluorophenyl)methyl]triazol-4-yl]methyl]-4-[(3-methylphenyl)methyl]piperazine (PubChem CID 155804078) has the molecular formula C22H26FN5 and a molecular weight of 379.48 g/mol. Its IUPAC name is 1-[[1-[(3-fluorophenyl)methyl]triazol-4-yl]methyl]-4-[(3-methylphenyl)methyl]piperazine.
| Compound Name | 1-[[1-[(3-fluorophenyl)methyl]triazol-4-yl]methyl]-4-[(3-methylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 155804078 |
| Molecular Formula | C22H26FN5 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | 1-[[1-[(3-fluorophenyl)methyl]triazol-4-yl]methyl]-4-[(3-methylphenyl)methyl]piperazine |
| SMILES | Cc1cccc(CN2CCN(Cc3cn(Cc4cccc(F)c4)nn3)CC2)c1 |
| InChI | InChI=1S/C22H26FN5/c1-18-4-2-5-19(12-18)14-26-8-10-27(11-9-26)16-22-17-28(25-24-22)15-20-6-3-7-21(23)13-20/h2-7,12-13,17H,8-11,14-16H2,1H3 |
| InChIKey | DGWIPDXRDFUQTF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |