C15H17F2NO — CID 167677057
1-[3-[[3-(1,1-difluoroethyl)phenyl]methyl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 167677057) has the molecular formula C15H17F2NO and a molecular weight of 265.30 g/mol. Its IUPAC name is 1-[3-[[3-(1,1-difluoroethyl)phenyl]methyl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[[3-(1,1-difluoroethyl)phenyl]methyl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167677057 |
| Molecular Formula | C15H17F2NO |
| Molecular Weight | 265.30 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-[3-[[3-(1,1-difluoroethyl)phenyl]methyl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(Cc2cccc(C(C)(F)F)c2)C1 |
| InChI | InChI=1S/C15H17F2NO/c1-3-14(19)18-9-12(10-18)7-11-5-4-6-13(8-11)15(2,16)17/h3-6,8,12H,1,7,9-10H2,2H3 |
| InChIKey | QALBZDTZQAQAQN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|