C21H36N2 — CID 142041044
N-[1-[3-[(3-tert-butylphenyl)methyl]azetidin-1-yl]ethenyl]propan-1-amine;ethane (PubChem CID 142041044) has the molecular formula C21H36N2 and a molecular weight of 316.53 g/mol. Its IUPAC name is N-[1-[3-[(3-tert-butylphenyl)methyl]azetidin-1-yl]ethenyl]propan-1-amine;ethane.
| Compound Name | N-[1-[3-[(3-tert-butylphenyl)methyl]azetidin-1-yl]ethenyl]propan-1-amine;ethane |
|---|---|
| PubChem CID | 142041044 |
| Molecular Formula | C21H36N2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | N-[1-[3-[(3-tert-butylphenyl)methyl]azetidin-1-yl]ethenyl]propan-1-amine;ethane |
| SMILES | C=C(NCCC)N1CC(Cc2cccc(C(C)(C)C)c2)C1.CC |
| InChI | InChI=1S/C19H30N2.C2H6/c1-6-10-20-15(2)21-13-17(14-21)11-16-8-7-9-18(12-16)19(3,4)5;1-2/h7-9,12,17,20H,2,6,10-11,13-14H2,1,3-5H3;1-2H3 |
| InChIKey | PXMFSIMAODKIPS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |