C14H18O2 — CID 118517725
(2R,3R,4R)-2,3-dimethyl-4-phenylmethoxy-3,4-dihydro-2H-pyran (PubChem CID 118517725) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (2R,3R,4R)-2,3-dimethyl-4-phenylmethoxy-3,4-dihydro-2H-pyran.
| Compound Name | (2R,3R,4R)-2,3-dimethyl-4-phenylmethoxy-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 118517725 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (2R,3R,4R)-2,3-dimethyl-4-phenylmethoxy-3,4-dihydro-2H-pyran |
| SMILES | C[C@@H]1[C@@H](C)OC=C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C14H18O2/c1-11-12(2)15-9-8-14(11)16-10-13-6-4-3-5-7-13/h3-9,11-12,14H,10H2,1-2H3/t11-,12-,14-/m1/s1 |
| InChIKey | WVOXIAPQTNEPKE-YRGRVCCFSA-N |
| XLogP | 3.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |