C21H24O4 — CID 101457735
(3R,4R,5R,7Z)-4,5-bis(phenylmethoxy)-3,4,5,6-tetrahydro-2H-oxocin-3-ol (PubChem CID 101457735) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is (3R,4R,5R,7Z)-4,5-bis(phenylmethoxy)-3,4,5,6-tetrahydro-2H-oxocin-3-ol.
| Compound Name | (3R,4R,5R,7Z)-4,5-bis(phenylmethoxy)-3,4,5,6-tetrahydro-2H-oxocin-3-ol |
|---|---|
| PubChem CID | 101457735 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (3R,4R,5R,7Z)-4,5-bis(phenylmethoxy)-3,4,5,6-tetrahydro-2H-oxocin-3-ol |
| SMILES | O[C@@H]1CO/C=C\C[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H24O4/c22-19-16-23-13-7-12-20(24-14-17-8-3-1-4-9-17)21(19)25-15-18-10-5-2-6-11-18/h1-11,13,19-22H,12,14-16H2/b13-7-/t19-,20-,21-/m1/s1 |
| InChIKey | YOOFIPUCELHWJY-SFUVMMPVSA-N |
| XLogP | 3.45 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |