C12H15IO3 — CID 10592798
(3R,4R,5R)-5-(iodomethyl)-4-phenylmethoxyoxolan-3-ol (PubChem CID 10592798) has the molecular formula C12H15IO3 and a molecular weight of 334.15 g/mol. Its IUPAC name is (3R,4R,5R)-5-(iodomethyl)-4-phenylmethoxyoxolan-3-ol.
| Compound Name | (3R,4R,5R)-5-(iodomethyl)-4-phenylmethoxyoxolan-3-ol |
|---|---|
| PubChem CID | 10592798 |
| Molecular Formula | C12H15IO3 |
| Molecular Weight | 334.15 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | (3R,4R,5R)-5-(iodomethyl)-4-phenylmethoxyoxolan-3-ol |
| SMILES | O[C@@H]1CO[C@@H](CI)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C12H15IO3/c13-6-11-12(10(14)8-15-11)16-7-9-4-2-1-3-5-9/h1-5,10-12,14H,6-8H2/t10-,11+,12-/m1/s1 |
| InChIKey | VOPUDMIOENWQAT-GRYCIOLGSA-N |
| XLogP | 1.77 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|