C34H26O6 — CID 56600059
(3R,4S,5S)-5-[12-[(2S,3S,4R)-4-hydroxy-3-phenylmethoxyoxolan-2-yl]dodeca-1,3,5,7,9,11-hexaynyl]-4-phenylmethoxyoxolan-3-ol (PubChem CID 56600059) has the molecular formula C34H26O6 and a molecular weight of 530.58 g/mol. Its IUPAC name is (3R,4S,5S)-5-[12-[(2S,3S,4R)-4-hydroxy-3-phenylmethoxyoxolan-2-yl]dodeca-1,3,5,7,9,11-hexaynyl]-4-phenylmethoxyoxolan-3-ol.
| Compound Name | (3R,4S,5S)-5-[12-[(2S,3S,4R)-4-hydroxy-3-phenylmethoxyoxolan-2-yl]dodeca-1,3,5,7,9,11-hexaynyl]-4-phenylmethoxyoxolan-3-ol |
|---|---|
| PubChem CID | 56600059 |
| Molecular Formula | C34H26O6 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | (3R,4S,5S)-5-[12-[(2S,3S,4R)-4-hydroxy-3-phenylmethoxyoxolan-2-yl]dodeca-1,3,5,7,9,11-hexaynyl]-4-phenylmethoxyoxolan-3-ol |
| SMILES | O[C@@H]1CO[C@@H](C#CC#CC#CC#CC#CC#C[C@@H]2OC[C@@H](O)[C@@H]2OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H26O6/c35-29-25-37-31(33(29)39-23-27-17-11-9-12-18-27)21-15-7-5-3-1-2-4-6-8-16-22-32-34(30(36)26-38-32)40-24-28-19-13-10-14-20-28/h9-14,17-20,29-36H,23-26H2/t29-,30-,31+,32+,33+,34+/m1/s1 |
| InChIKey | YLACFDNJRYSXFO-ZRBWWFCKSA-N |
| XLogP | 1.70 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|