C15H13BrO3 — CID 56599854
(3R,4S,5S)-5-(4-bromobuta-1,3-diynyl)-4-phenylmethoxyoxolan-3-ol (PubChem CID 56599854) has the molecular formula C15H13BrO3 and a molecular weight of 321.17 g/mol. Its IUPAC name is (3R,4S,5S)-5-(4-bromobuta-1,3-diynyl)-4-phenylmethoxyoxolan-3-ol.
| Compound Name | (3R,4S,5S)-5-(4-bromobuta-1,3-diynyl)-4-phenylmethoxyoxolan-3-ol |
|---|---|
| PubChem CID | 56599854 |
| Molecular Formula | C15H13BrO3 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | (3R,4S,5S)-5-(4-bromobuta-1,3-diynyl)-4-phenylmethoxyoxolan-3-ol |
| SMILES | O[C@@H]1CO[C@@H](C#CC#CBr)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C15H13BrO3/c16-9-5-4-8-14-15(13(17)11-18-14)19-10-12-6-2-1-3-7-12/h1-3,6-7,13-15,17H,10-11H2/t13-,14+,15+/m1/s1 |
| InChIKey | FEZTZYZKJWMVEW-ILXRZTDVSA-N |
| XLogP | 1.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|