C21H28O3Si — CID 56599853
(3R,4S,5S)-4-phenylmethoxy-5-(4-triethylsilylbuta-1,3-diynyl)oxolan-3-ol (PubChem CID 56599853) has the molecular formula C21H28O3Si and a molecular weight of 356.54 g/mol. Its IUPAC name is (3R,4S,5S)-4-phenylmethoxy-5-(4-triethylsilylbuta-1,3-diynyl)oxolan-3-ol.
| Compound Name | (3R,4S,5S)-4-phenylmethoxy-5-(4-triethylsilylbuta-1,3-diynyl)oxolan-3-ol |
|---|---|
| PubChem CID | 56599853 |
| Molecular Formula | C21H28O3Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (3R,4S,5S)-4-phenylmethoxy-5-(4-triethylsilylbuta-1,3-diynyl)oxolan-3-ol |
| SMILES | CC[Si](C#CC#C[C@@H]1OC[C@@H](O)[C@@H]1OCc1ccccc1)(CC)CC |
| InChI | InChI=1S/C21H28O3Si/c1-4-25(5-2,6-3)15-11-10-14-20-21(19(22)17-23-20)24-16-18-12-8-7-9-13-18/h7-9,12-13,19-22H,4-6,16-17H2,1-3H3/t19-,20+,21+/m1/s1 |
| InChIKey | YPSFOEVOMHNPGR-HKBOAZHASA-N |
| XLogP | 3.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|